| שם המוצר |
2,3-Dimethylcyclohexylamine, mixture of isomers |
| שם אנגלי |
2,3-Dimethylcyclohexylamine, mixture of isomers; 2,3-Dimethylcyclohexylamine; 2,3-dimethylcyclohexanamine; (1S,2R,3S)-2,3-dimethylcyclohexanaminium; (1S,2R,3R)-2,3-dimethylcyclohexanaminium; (1R,2R,3R)-2,3-dimethylcyclohexanaminium; (1R,2R,3S)-2,3-dimethylcyclohexanaminium; (1R,2R,3S)-2,3-dimethylcyclohexanamine |
| מולקולרית פורמולה |
C8H17N |
| משקל מולקולרי |
127.2273 |
| InChI |
InChI=1/C8H17N/c1-6-4-3-5-8(9)7(6)2/h6-8H,3-5,9H2,1-2H3/t6-,7+,8+/m0/s1 |
| מספר CAS |
42195-92-6 |
| EINECS |
255-704-2 |
| מבנה מולקולרי |
|
| צפיפות |
0.826g/cm3 |
| נקודת רתיחה |
160.348°C at 760 mmHg |
| משקל סגולי |
1.441 |
| נקודת הבזק |
30.014°C |
| לחץ אדים |
2.396mmHg at 25°C |
| Hazard סימנים |
 C:Corrosive;
|
| סיכונים קודי |
R10:Flammable.;
R34:Causes burns.;
|
| בטיחות תיאור |
S16:Keep away from sources of ignition - No smoking.;
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
