ChemNet > CAS > 4286-15-1 S(+)-2-phenylbutyric acid
4286-15-1 S(+)-2-phenylbutyric acid
שם המוצר |
S(+)-2-phenylbutyric acid |
שם אנגלי |
S(+)-2-phenylbutyric acid; (S)-(+)-2-Phenylbutyric acid; (S)-(+)-alpha-Ethylphenylacetic acid; (2S)-2-phenylbutanoic acid |
מולקולרית פורמולה |
C10H12O2 |
משקל מולקולרי |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12)/t9-/m0/s1 |
מספר CAS |
4286-15-1 |
EINECS |
201-982-5 |
מבנה מולקולרי |
|
צפיפות |
1.09g/cm3 |
נקודת רתיחה |
272.9°C at 760 mmHg |
משקל סגולי |
1.531 |
נקודת הבזק |
170.2°C |
לחץ אדים |
0.00288mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|