ChemNet > CAS > 4347-31-3 2-Formylthiophene-3-boronic acid
4347-31-3 2-Formylthiophene-3-boronic acid
שם המוצר |
2-Formylthiophene-3-boronic acid |
שם אנגלי |
2-Formylthiophene-3-boronic acid; 3-Boronothiophene-2-carboxaldehyde; (2-Formyl-3-thienyl)boronic acid; (2-formylthiophen-3-yl)boronic acid |
מולקולרית פורמולה |
C5H5BO3S |
משקל מולקולרי |
155.9674 |
InChI |
InChI=1/C5H5BO3S/c7-3-5-4(6(8)9)1-2-10-5/h1-3,8-9H |
מספר CAS |
4347-31-3 |
מבנה מולקולרי |
|
צפיפות |
1.41g/cm3 |
נקודת ההתוך |
167-173℃ |
נקודת רתיחה |
396.7°C at 760 mmHg |
משקל סגולי |
1.573 |
נקודת הבזק |
193.7°C |
לחץ אדים |
5.27E-07mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|