ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
שם המוצר |
4-Isopropylphenylacetonitrile |
שם אנגלי |
4-Isopropylphenylacetonitrile; [4-(propan-2-yl)phenyl]acetonitrile; 4-Isopropylphenylaceotnitrile |
מולקולרית פורמולה |
C11H13N |
משקל מולקולרי |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
מספר CAS |
4395-87-3 |
מבנה מולקולרי |
|
צפיפות |
0.96g/cm3 |
נקודת רתיחה |
261.1°C at 760 mmHg |
משקל סגולי |
1.514 |
נקודת הבזק |
117.5°C |
לחץ אדים |
0.0118mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|