4569-88-4 indoine blue
שם המוצר |
indoine blue |
שם אנגלי |
indoine blue;C.I. 12210; C.I. Basic Blue 16; Janus blue; Basic blue 16; 3-Amino-2,8-dimethyl-7-(2-hydroxy-1-naphthylazo)-5-phenylazinium chloride; 3-amino-2,8-dimethyl-7-[2-(2-oxonaphthalen-1(2H)-ylidene)hydrazino]-5-phenylphenazin-5-ium chloride |
מולקולרית פורמולה |
C30H24ClN5O |
משקל מולקולרי |
505.9975 |
InChI |
InChI=1/C30H23N5O.ClH/c1-18-14-25-27(16-23(18)31)35(21-9-4-3-5-10-21)28-17-24(19(2)15-26(28)32-25)33-34-30-22-11-7-6-8-20(22)12-13-29(30)36;/h3-17H,1-2H3,(H2,31,33,36);1H |
מספר CAS |
4569-88-4 |
EINECS |
224-951-8 |
מבנה מולקולרי |
|
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|