שם המוצר |
טרנס-3,6-אנדו-מתילן-1,2,3,6-טטרהידרופתלויל כלוריד |
נרדפות |
טרנס-5-נורבורן-2,3-דיקרבוניל כלוריד; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl כלוריד; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
שם אנגלי |
trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride; trans-5-Norbornene-2,3-dicarbonyl chloride; Bicyclo[2.2.1]-5-heptene-2,3-dicarbonyl Chloride; bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride; (1R,2S,3S,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride |
מולקולרית פורמולה |
C9H8Cl2O2 |
משקל מולקולרי |
219.0646 |
InChI |
InChI=1/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m0/s1 |
מספר CAS |
4582-21-2 |
EINECS |
224-967-5 |
מבנה מולקולרי |
|
צפיפות |
1.453g/cm3 |
נקודת רתיחה |
243.334°C at 760 mmHg |
משקל סגולי |
1.56 |
נקודת הבזק |
133.454°C |
לחץ אדים |
0.032mmHg at 25°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|