ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
שם המוצר |
2-aminothiophene-3-carbonitrile |
שם אנגלי |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
מולקולרית פורמולה |
C5H4N2S |
משקל מולקולרי |
124.1637 |
InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
מספר CAS |
4651-82-5 |
מבנה מולקולרי |
|
צפיפות |
1.33g/cm3 |
נקודת ההתוך |
104℃ |
נקודת רתיחה |
317.5°C at 760 mmHg |
משקל סגולי |
1.627 |
נקודת הבזק |
145.8°C |
לחץ אדים |
0.000384mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|