4731-53-7 Tri-n-octylphosphine
שם המוצר |
Tri-n-octylphosphine |
שם אנגלי |
Tri-n-octylphosphine;Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
מולקולרית פורמולה |
C24H51P |
משקל מולקולרי |
370.6355 |
InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
מספר CAS |
4731-53-7 |
EINECS |
225-234-2 |
מבנה מולקולרי |
|
נקודת רתיחה |
445°C at 760 mmHg |
נקודת הבזק |
236°C |
לחץ אדים |
1.07E-07mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|