ChemNet > CAS > 4771-50-0 7-methylindole 3-carboxaldehyde
4771-50-0 7-methylindole 3-carboxaldehyde
שם המוצר |
7-methylindole 3-carboxaldehyde |
שם אנגלי |
7-methylindole 3-carboxaldehyde; 7-Methylindole-3-carboxaldehyde; 3-Formyl-7-methylindole; 7-methyl-1H-indole-3-carbaldehyde |
מולקולרית פורמולה |
C10H9NO |
משקל מולקולרי |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-3-2-4-9-8(6-12)5-11-10(7)9/h2-6,11H,1H3 |
מספר CAS |
4771-50-0 |
מבנה מולקולרי |
|
צפיפות |
1.226g/cm3 |
נקודת רתיחה |
341°C at 760 mmHg |
משקל סגולי |
1.698 |
נקודת הבזק |
168°C |
לחץ אדים |
8.31E-05mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|