4946-14-9 p-isoPropyl Thiophenol
שם המוצר |
p-isoPropyl Thiophenol |
שם אנגלי |
p-isoPropyl Thiophenol; 4-Isopropylthiophenol; 4-Isopropylbenzenethiol; 4-(propan-2-yl)benzenethiol; 4-(1-methylethyl)benzenethiolate; (4-Isopropyl)thiophenol |
מולקולרית פורמולה |
C9H11S |
משקל מולקולרי |
151.2492 |
InChI |
InChI=1/C9H12S/c1-7(2)8-3-5-9(10)6-4-8/h3-7,10H,1-2H3/p-1 |
מספר CAS |
4946-14-9 |
מבנה מולקולרי |
|
נקודת רתיחה |
215.1°C at 760 mmHg |
נקודת הבזק |
86.4°C |
לחץ אדים |
0.22mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|