4964-71-0 5-Bromo-quinoline
שם המוצר |
5-Bromo-quinoline |
שם אנגלי |
5-Bromo-quinoline; 5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
מולקולרית פורמולה |
C9H6BrN |
משקל מולקולרי |
208.0546 |
InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
מספר CAS |
4964-71-0 |
מבנה מולקולרי |
|
צפיפות |
1.564g/cm3 |
נקודת רתיחה |
295.9°C at 760 mmHg |
משקל סגולי |
1.673 |
נקודת הבזק |
132.8°C |
לחץ אדים |
0.00261mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|