ChemNet > CAS > 498-74-8 4-Methoxymetanilyl fluoride
498-74-8 4-Methoxymetanilyl fluoride
שם המוצר |
4-Methoxymetanilyl fluoride |
שם אנגלי |
4-Methoxymetanilyl fluoride; 3-amino-4-methoxyphenylsulphonyl fluoride; Aminomethoxybenzenesulfonylfluoride; 3-Amino-4-methoxAV21428; 3-amino-4-methoxybenzenesulfonyl fluoride; 3-fluorobenzohydrazide |
מולקולרית פורמולה |
C7H7FN2O |
משקל מולקולרי |
154.1417 |
InChI |
InChI=1/C7H7FN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
מספר CAS |
498-74-8 |
EINECS |
207-870-2 |
מבנה מולקולרי |
|
צפיפות |
1.272g/cm3 |
נקודת ההתוך |
60-65℃ |
נקודת רתיחה |
312.6°C at 760 mmHg |
משקל סגולי |
1.552 |
נקודת הבזק |
142.8°C |
לחץ אדים |
0.000224mmHg at 25°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|