ChemNet > CAS > 524-42-5 1,2-Naphthoquinone
524-42-5 1,2-Naphthoquinone
שם המוצר |
1,2-Naphthoquinone |
שם אנגלי |
1,2-Naphthoquinone; 1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
מולקולרית פורמולה |
C10H6O2 |
משקל מולקולרי |
158.1534 |
InChI |
InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
מספר CAS |
524-42-5 |
EINECS |
208-360-2 |
מבנה מולקולרי |
|
צפיפות |
1.29g/cm3 |
נקודת ההתוך |
136-141℃ |
נקודת רתיחה |
296.1°C at 760 mmHg |
משקל סגולי |
1.617 |
נקודת הבזק |
117.4°C |
לחץ אדים |
0.00147mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|