53-96-3 2-Acetamidofluorene
שם המוצר |
2-Acetamidofluorene |
שם אנגלי |
2-Acetamidofluorene; N-(2-Fluorenyl)acetamide; Acetamidofluorene; N-(9H-fluoren-2-yl)acetamide; 2-(9H-fluoren-2-yl)acetamide |
מולקולרית פורמולה |
C15H13NO |
משקל מולקולרי |
223.2698 |
InChI |
InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
מספר CAS |
53-96-3 |
EINECS |
200-188-6 |
מבנה מולקולרי |
|
צפיפות |
1.227g/cm3 |
נקודת ההתוך |
192-196℃ |
נקודת רתיחה |
471.2°C at 760 mmHg |
משקל סגולי |
1.656 |
נקודת הבזק |
238.8°C |
מסיסות במים |
0.000529 g/100 mL |
לחץ אדים |
4.73E-09mmHg at 25°C |
Hazard סימנים |
T:Toxic;
|
סיכונים קודי |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R46:May cause heritable genetic damages.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|