535-32-0 D-Ethionine
שם המוצר |
D-Ethionine |
שם אנגלי |
D-Ethionine; D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
מולקולרית פורמולה |
C6H13NO2S |
משקל מולקולרי |
163.2379 |
InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
מספר CAS |
535-32-0 |
EINECS |
208-612-1 |
מבנה מולקולרי |
|
צפיפות |
1.164g/cm3 |
נקודת ההתוך |
278℃ |
נקודת רתיחה |
310.4°C at 760 mmHg |
משקל סגולי |
1.523 |
נקודת הבזק |
141.5°C |
לחץ אדים |
0.000133mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R40:Possible risks of irreversible effects.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|