ChemNet > CAS > 5391-30-0 2-Bromophenylthiourea
5391-30-0 2-Bromophenylthiourea
| שם המוצר |
2-Bromophenylthiourea |
| שם אנגלי |
2-Bromophenylthiourea;Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| מולקולרית פורמולה |
C7H7BrN2S |
| משקל מולקולרי |
231.1129 |
| InChI |
InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| מספר CAS |
5391-30-0 |
| מבנה מולקולרי |
|
| צפיפות |
1.728g/cm3 |
| נקודת רתיחה |
314.2°C at 760 mmHg |
| משקל סגולי |
1.748 |
| נקודת הבזק |
143.8°C |
| לחץ אדים |
0.000474mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R25:Toxic if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
