ChemNet > CAS > 55406-13-8 3-Methylthiophene-2-carbonitrile
55406-13-8 3-Methylthiophene-2-carbonitrile
| שם המוצר |
3-Methylthiophene-2-carbonitrile |
| שם אנגלי |
3-Methylthiophene-2-carbonitrile; 2-Cyano-3-methylthiophene |
| מולקולרית פורמולה |
C6H5NS |
| משקל מולקולרי |
123.1756 |
| InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
| מספר CAS |
55406-13-8 |
| מבנה מולקולרי |
|
| צפיפות |
1.16g/cm3 |
| נקודת רתיחה |
212.7°C at 760 mmHg |
| משקל סגולי |
1.556 |
| נקודת הבזק |
82.4°C |
| לחץ אדים |
0.171mmHg at 25°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
