שם המוצר |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, תרכובת עם 1-aminopropan-2-ol (1:1) |
נרדפות |
תיאופילין איזופרופנולמין; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, תרכובת עם 1-aminopropan-2-ol (1:1); 1,3-דימתיל-3,7-דיהידרו-1H-פורין-2,6-דיון; 1,3-דימתיל-3,7-דיהידרו-1H-פורין-2,6-דיון - 1-אמינופרופן-2-ol (1:1) |
שם אנגלי |
3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1);Theophylline isopropanolamine; 3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, compound with 1-aminopropan-2-ol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 1-aminopropan-2-ol (1:1) |
מולקולרית פורמולה |
C10H17N5O3 |
משקל מולקולרי |
255.2737 |
InChI |
InChI=1/C7H8N4O2.C3H9NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-3(5)2-4/h3H,1-2H3,(H,8,9);3,5H,2,4H2,1H3 |
מספר CAS |
5600-19-1 |
EINECS |
227-017-8 |
מבנה מולקולרי |
|
נקודת רתיחה |
454.1°C at 760 mmHg |
נקודת הבזק |
228.4°C |
לחץ אדים |
1.96E-08mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|