ChemNet > CAS > 56107-02-9 4-Chloro-3-nitrobenzophenone
56107-02-9 4-Chloro-3-nitrobenzophenone
| שם המוצר |
4-Chloro-3-nitrobenzophenone |
| שם אנגלי |
4-Chloro-3-nitrobenzophenone; (4-Chloro-3-nitrophenyl)phenylmethanone |
| מולקולרית פורמולה |
C13H8ClNO3 |
| משקל מולקולרי |
261.6605 |
| InChI |
InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
| מספר CAS |
56107-02-9 |
| EINECS |
259-995-7 |
| מבנה מולקולרי |
|
| צפיפות |
1.367g/cm3 |
| נקודת ההתוך |
101-107℃ |
| נקודת רתיחה |
386.5°C at 760 mmHg |
| משקל סגולי |
1.623 |
| נקודת הבזק |
203.4°C |
| לחץ אדים |
3.53E-06mmHg at 25°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21:Harmful by inhalation and in contact with skin.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
