ChemNet > CAS > 576-82-9 5-Fluoro-1,2,3-tribromobenzene
576-82-9 5-Fluoro-1,2,3-tribromobenzene
שם המוצר |
5-Fluoro-1,2,3-tribromobenzene |
נרדפות |
; 1,2,3-טריברומו-5-פלואורובנזן |
שם אנגלי |
5-Fluoro-1,2,3-tribromobenzene; 1,2,3-Tribromo-5-fluorobenzene |
מולקולרית פורמולה |
C6H2Br3F |
משקל מולקולרי |
332.7905 |
InChI |
InChI=1/C6H2Br3F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H |
מספר CAS |
576-82-9 |
מבנה מולקולרי |
|
צפיפות |
2.34g/cm3 |
נקודת רתיחה |
274.2°C at 760 mmHg |
משקל סגולי |
1.61 |
נקודת הבזק |
119.6°C |
לחץ אדים |
0.0092mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|