60-93-5 quinine dihydrochloride
שם המוצר |
quinine dihydrochloride |
שם אנגלי |
quinine dihydrochloride; Quinine Dihydochloride; (8alpha,9R)-6'-methoxycinchonan-9-ol dihydrochloride |
מולקולרית פורמולה |
C20H26Cl2N2O2 |
משקל מולקולרי |
397.3386 |
InChI |
InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
מספר CAS |
60-93-5 |
EINECS |
200-493-4 |
מבנה מולקולרי |
|
נקודת רתיחה |
495.9°C at 760 mmHg |
נקודת הבזק |
253.7°C |
לחץ אדים |
1.19E-10mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R22:Harmful if swallowed.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|