605-69-6 Martius Yellow
שם המוצר |
Martius Yellow |
שם אנגלי |
Martius Yellow;C.I. 10315; Martius yellow; 2,4-Dinitro-1-naphthol; Acid Yellow 24; C.I. 10315~Martius Yellow; 2,4-dinitronaphthalen-1-ol; 2,4-dinitronaphthalen-1-olate |
מולקולרית פורמולה |
C10H5N2O5 |
משקל מולקולרי |
233.1576 |
InChI |
InChI=1/C10H6N2O5/c13-10-7-4-2-1-3-6(7)8(11(14)15)5-9(10)12(16)17/h1-5,13H/p-1 |
מספר CAS |
605-69-6 |
EINECS |
210-093-1 |
מבנה מולקולרי |
|
נקודת ההתוך |
130-133℃ |
נקודת רתיחה |
407.9°C at 760 mmHg |
נקודת הבזק |
179.9°C |
לחץ אדים |
3.08E-07mmHg at 25°C |
Hazard סימנים |
T:Toxic;
|
סיכונים קודי |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|