ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
| שם המוצר |
2,5-Dihydroxy-1,4-benzoquinone |
| שם אנגלי |
2,5-Dihydroxy-1,4-benzoquinone; 2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| מולקולרית פורמולה |
C6H4O4 |
| משקל מולקולרי |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| מספר CAS |
615-94-1 |
| EINECS |
210-454-3 |
| מבנה מולקולרי |
|
| צפיפות |
1.843g/cm3 |
| נקודת ההתוך |
220℃ |
| נקודת רתיחה |
322.3°C at 760 mmHg |
| משקל סגולי |
1.729 |
| נקודת הבזק |
162.9°C |
| לחץ אדים |
2.24E-05mmHg at 25°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
