622-52-6 P-Tolylthiourea
שם המוצר |
P-Tolylthiourea |
שם אנגלי |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
מולקולרית פורמולה |
C8H10N2S |
משקל מולקולרי |
166.2434 |
InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
מספר CAS |
622-52-6 |
EINECS |
210-740-8 |
מבנה מולקולרי |
|
צפיפות |
1.242g/cm3 |
נקודת רתיחה |
282.5°C at 760 mmHg |
משקל סגולי |
1.696 |
נקודת הבזק |
124.6°C |
לחץ אדים |
0.00335mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R25:Toxic if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|