625-48-9 2-Nitroethanol
שם המוצר |
2-Nitroethanol |
שם אנגלי |
2-Nitroethanol;1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
מולקולרית פורמולה |
C2H5NO3 |
משקל מולקולרי |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
מספר CAS |
625-48-9 |
EINECS |
210-895-1 |
מבנה מולקולרי |
|
צפיפות |
1.267g/cm3 |
נקודת רתיחה |
193.8°C at 760 mmHg |
משקל סגולי |
1.438 |
נקודת הבזק |
113.8°C |
לחץ אדים |
0.12mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|