626-04-0 benzene-1,3-dithiol
שם המוצר |
benzene-1,3-dithiol |
שם אנגלי |
benzene-1,3-dithiol; 1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
מולקולרית פורמולה |
C6H6S2 |
משקל מולקולרי |
142.2418 |
InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
מספר CAS |
626-04-0 |
EINECS |
210-925-3 |
מבנה מולקולרי |
|
צפיפות |
1.24g/cm3 |
נקודת ההתוך |
24-25℃ |
נקודת רתיחה |
244.3°C at 760 mmHg |
משקל סגולי |
1.665 |
נקודת הבזק |
112.7°C |
לחץ אדים |
0.0477mmHg at 25°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|