627-04-3 (Ethylthio)acetic acid
שם המוצר |
(Ethylthio)acetic acid |
שם אנגלי |
(Ethylthio)acetic acid; S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
מולקולרית פורמולה |
C4H8O2S |
משקל מולקולרי |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
מספר CAS |
627-04-3 |
EINECS |
210-979-8 |
מבנה מולקולרי |
|
צפיפות |
1.164g/cm3 |
נקודת רתיחה |
229°C at 760 mmHg |
משקל סגולי |
1.496 |
נקודת הבזק |
92.3°C |
לחץ אדים |
0.0254mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|