ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
שם המוצר |
4,5-Dibromothiophene-2-carboxylic acid |
שם אנגלי |
4,5-Dibromothiophene-2-carboxylic acid;4,5-Dibromothenoic acid |
מולקולרית פורמולה |
C5H2Br2O2S |
משקל מולקולרי |
285.9412 |
InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
מספר CAS |
6324-10-3 |
EINECS |
228-683-2 |
מבנה מולקולרי |
|
צפיפות |
2.309g/cm3 |
נקודת רתיחה |
367.1°C at 760 mmHg |
משקל סגולי |
1.682 |
נקודת הבזק |
175.8°C |
לחץ אדים |
4.91E-06mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|