ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
שם המוצר |
5-nitro-1-benzothiophene-2-carboxylic acid |
שם אנגלי |
5-nitro-1-benzothiophene-2-carboxylic acid;5-nitro-1-benzothiophene-2-carboxylate |
מולקולרית פורמולה |
C9H4NO4S |
משקל מולקולרי |
222.1979 |
InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
מספר CAS |
6345-55-7 |
מבנה מולקולרי |
|
נקודת ההתוך |
238℃ |
נקודת רתיחה |
473.6°C at 760 mmHg |
נקודת הבזק |
240.2°C |
לחץ אדים |
8.93E-10mmHg at 25°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|