643-28-7 2-Isopropylaniline
שם המוצר |
2-Isopropylaniline |
שם אנגלי |
2-Isopropylaniline; 2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
מולקולרית פורמולה |
C9H13N |
משקל מולקולרי |
135.2062 |
InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
מספר CAS |
643-28-7 |
EINECS |
211-397-7 |
מבנה מולקולרי |
|
צפיפות |
0.953g/cm3 |
נקודת רתיחה |
225.6°C at 760 mmHg |
משקל סגולי |
1.542 |
נקודת הבזק |
95.6°C |
לחץ אדים |
0.0858mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|