ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
| שם המוצר |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
| שם אנגלי |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile;1-(4-Chlorophenyl)cyclohexanecarbonitrile |
| מולקולרית פורמולה |
C13H14ClN |
| משקל מולקולרי |
219.71 |
| InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
| מספר CAS |
64399-28-6 |
| EINECS |
264-872-6 |
| מבנה מולקולרי |
|
| צפיפות |
1.14g/cm3 |
| נקודת ההתוך |
88-92℃ |
| נקודת רתיחה |
350.5°C at 760 mmHg |
| משקל סגולי |
1.559 |
| נקודת הבזק |
143.5°C |
| לחץ אדים |
4.38E-05mmHg at 25°C |
| Hazard סימנים |
 Xi:Irritant;
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|
