ChemNet > CAS > 6575-13-9 2,6-Dimethylbenzonitrile
6575-13-9 2,6-Dimethylbenzonitrile
שם המוצר |
2,6-Dimethylbenzonitrile |
שם אנגלי |
2,6-Dimethylbenzonitrile; 2,6-Dimethylbenzoniitrile |
מולקולרית פורמולה |
C9H9N |
משקל מולקולרי |
131.1745 |
InChI |
InChI=1/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
מספר CAS |
6575-13-9 |
EINECS |
229-503-5 |
מבנה מולקולרי |
|
צפיפות |
0.99g/cm3 |
נקודת ההתוך |
87-89℃ |
נקודת רתיחה |
228.7°C at 760 mmHg |
משקל סגולי |
1.525 |
נקודת הבזק |
91.9°C |
לחץ אדים |
0.0725mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|