ChemNet > CAS > 6609-54-7 2-(Methylthio)benzonitrile
6609-54-7 2-(Methylthio)benzonitrile
שם המוצר |
2-(Methylthio)benzonitrile |
שם אנגלי |
2-(Methylthio)benzonitrile; 2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
מולקולרית פורמולה |
C8H7NS |
משקל מולקולרי |
149.2129 |
InChI |
InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
מספר CAS |
6609-54-7 |
מבנה מולקולרי |
|
צפיפות |
1.14g/cm3 |
נקודת רתיחה |
263.9°C at 760 mmHg |
משקל סגולי |
1.589 |
נקודת הבזק |
113.4°C |
לחץ אדים |
0.00999mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|