ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
| שם המוצר |
2-Amino-5-methoxybenzoic acid |
| שם אנגלי |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
| מולקולרית פורמולה |
C8H8N2O |
| משקל מולקולרי |
148.1619 |
| InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
| מספר CAS |
6705-03-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.17g/cm3 |
| נקודת ההתוך |
148-152℃ |
| נקודת רתיחה |
302.2°C at 760 mmHg |
| משקל סגולי |
1.569 |
| נקודת הבזק |
136.6°C |
| לחץ אדים |
0.00101mmHg at 25°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R22:;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
