ChemNet > CAS > 67973-32-4 3,5-Dibromo-4-methylbenzoic acid
67973-32-4 3,5-Dibromo-4-methylbenzoic acid
שם המוצר |
3,5-Dibromo-4-methylbenzoic acid |
שם אנגלי |
3,5-Dibromo-4-methylbenzoic acid; 3,5-Dibromo-p-toluic acid (COOH=1); 3,5-Dibromo-p-toluic acid |
מולקולרית פורמולה |
C8H6Br2O2 |
משקל מולקולרי |
293.94 |
InChI |
InChI=1/C8H6Br2O2/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12) |
מספר CAS |
67973-32-4 |
מבנה מולקולרי |
|
צפיפות |
1.951g/cm3 |
נקודת רתיחה |
374.6°C at 760 mmHg |
משקל סגולי |
1.627 |
נקודת הבזק |
180.3°C |
לחץ אדים |
2.82E-06mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|