ChemNet > CAS > 6950-92-1 2,4,6-Trimethylphenethylalcohol
6950-92-1 2,4,6-Trimethylphenethylalcohol
שם המוצר |
2,4,6-Trimethylphenethylalcohol |
שם אנגלי |
2,4,6-Trimethylphenethylalcohol; 2-Mesitylethanol; 2-Hydroxyethylmesitylene~2,4,6-Trimethylphenethyl alcohol~2-(2,4,6-Trimethylphenyl)ethanol; 2-(2,4,6-trimethylphenyl)ethanol |
מולקולרית פורמולה |
C11H16O |
משקל מולקולרי |
164.2441 |
InChI |
InChI=1/C11H16O/c1-8-6-9(2)11(4-5-12)10(3)7-8/h6-7,12H,4-5H2,1-3H3 |
מספר CAS |
6950-92-1 |
EINECS |
230-123-7 |
מבנה מולקולרי |
|
צפיפות |
0.974g/cm3 |
נקודת רתיחה |
290.7°C at 760 mmHg |
משקל סגולי |
1.526 |
נקודת הבזק |
138.4°C |
לחץ אדים |
0.000939mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|