ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
שם המוצר |
2,4-Dichloro-6-iodoaniline |
שם אנגלי |
2,4-Dichloro-6-iodoaniline; |
מולקולרית פורמולה |
C6H4Cl2IN |
משקל מולקולרי |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
מספר CAS |
697-90-5 |
מבנה מולקולרי |
|
צפיפות |
2.091g/cm3 |
נקודת רתיחה |
303.8°C at 760 mmHg |
משקל סגולי |
1.699 |
נקודת הבזק |
137.5°C |
לחץ אדים |
0.000911mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|