ChemNet > CAS > 72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
72-55-9 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene
שם המוצר |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
שם אנגלי |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
מולקולרית פורמולה |
C14H8Cl4 |
משקל מולקולרי |
318.02 |
InChI |
InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
מספר CAS |
72-55-9 |
EINECS |
200-784-6 |
מבנה מולקולרי |
|
נקודת ההתוך |
87-90℃ |
מסיסות במים |
0.00000013 g/100 mL |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:Harmful if swallowed.;
R33:Danger of cummulative effects.;
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|