ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
שם המוצר |
N-Acryloylsarcosine methyl ester |
שם אנגלי |
N-Acryloylsarcosine methyl ester;methyl N-acryloyl-N-methylglycinate |
מולקולרית פורמולה |
C7H11NO3 |
משקל מולקולרי |
157.1671 |
InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
מספר CAS |
72065-23-7 |
מבנה מולקולרי |
|
צפיפות |
1.068g/cm3 |
נקודת רתיחה |
276.3°C at 760 mmHg |
משקל סגולי |
1.452 |
נקודת הבזק |
120.9°C |
לחץ אדים |
0.00485mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/38:Irritating to eyes and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|