7472-43-7 6-Benzoylhexanoic acid
שם המוצר |
6-Benzoylhexanoic acid |
שם אנגלי |
6-Benzoylhexanoic acid; 7-Oxo-7-phenylheptanoic acid; 7-Oxo-7-phenyl-heptanoic acid; 6-Benzoyl hexanoic Acid |
מולקולרית פורמולה |
C13H16O3 |
משקל מולקולרי |
220.2643 |
InChI |
InChI=1/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
מספר CAS |
7472-43-7 |
מבנה מולקולרי |
|
צפיפות |
1.111g/cm3 |
נקודת רתיחה |
396°C at 760 mmHg |
משקל סגולי |
1.528 |
נקודת הבזק |
207.4°C |
לחץ אדים |
5.57E-07mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|