75-27-4 Bromodichloromethane
שם המוצר |
Bromodichloromethane |
שם אנגלי |
Bromodichloromethane; FC-20B1 |
מולקולרית פורמולה |
CHBrCl2 |
משקל מולקולרי |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
מספר CAS |
75-27-4 |
EINECS |
200-856-7 |
מבנה מולקולרי |
|
צפיפות |
2.013g/cm3 |
נקודת ההתוך |
-55℃ |
נקודת רתיחה |
89.7°C at 760 mmHg |
משקל סגולי |
1.503 |
נקודת הבזק |
1.3°C |
לחץ אדים |
65.3mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|