ChemNet > CAS > 7756-94-7 Triisobutylene (mixture of branched chain isomer)
7756-94-7 Triisobutylene (mixture of branched chain isomer)
שם המוצר |
Triisobutylene (mixture of branched chain isomer) |
שם אנגלי |
Triisobutylene (mixture of branched chain isomer); 1-Propene, 2-methyl-, trimer; Triisobutylene; Triisobutylene [UN2324] [Flammable liquid]; UN2324; tert-butyl |
מולקולרית פורמולה |
C4H9 |
משקל מולקולרי |
57.1143 |
InChI |
InChI=1/C4H9/c1-4(2)3/h1-3H3 |
מספר CAS |
7756-94-7 |
מבנה מולקולרי |
|
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|