ChemNet > CAS > 79757-77-0 (4-bromo-2-thienyl)methanol
79757-77-0 (4-bromo-2-thienyl)methanol
| שם המוצר |
(4-bromo-2-thienyl)methanol |
| שם אנגלי |
(4-bromo-2-thienyl)methanol; (4-bromothiophen-2-yl)methanol; (4-Bromothien-2-yl)methanol |
| מולקולרית פורמולה |
C5H5BrOS |
| משקל מולקולרי |
193.0616 |
| InChI |
InChI=1/C5H5BrOS/c6-4-1-5(2-7)8-3-4/h1,3,7H,2H2 |
| מספר CAS |
79757-77-0 |
| מבנה מולקולרי |
|
| צפיפות |
1.773g/cm3 |
| נקודת רתיחה |
271.491°C at 760 mmHg |
| משקל סגולי |
1.631 |
| נקודת הבזק |
117.994°C |
| לחץ אדים |
0.003mmHg at 25°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
