ChemNet > CAS > 817-09-4 Tris(2-chloroethyl)amine hydrochloride
817-09-4 Tris(2-chloroethyl)amine hydrochloride
| שם המוצר |
Tris(2-chloroethyl)amine hydrochloride |
| שם אנגלי |
Tris(2-chloroethyl)amine hydrochloride; 2,2,2-Trichlorotriethylamine hydrochloride; 2-chloro-N,N-bis(2-chloroethyl)ethanaminium; Tris-(2-chloroethyl)amine hydrochloride |
| מולקולרית פורמולה |
C6H13Cl3N |
| משקל מולקולרי |
205.5326 |
| InChI |
InChI=1/C6H12Cl3N/c7-1-4-10(5-2-8)6-3-9/h1-6H2/p+1 |
| מספר CAS |
817-09-4 |
| EINECS |
212-442-3 |
| מבנה מולקולרי |
|
| נקודת ההתוך |
127-132℃ |
| נקודת רתיחה |
156.2°C at 760 mmHg |
| נקודת הבזק |
48.3°C |
| לחץ אדים |
2.92mmHg at 25°C |
| Hazard סימנים |
 T+:Very toxic;
|
| סיכונים קודי |
R26/27/28:Very toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R40:Possible risks of irreversible effects.;
|
| בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
