827-15-6 iodopentafluorobenzene
שם המוצר |
iodopentafluorobenzene |
שם אנגלי |
iodopentafluorobenzene; Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene; 1-Iodo-2,3,4,5,6-Pentafluorobenzene |
מולקולרית פורמולה |
C6F5I |
משקל מולקולרי |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
מספר CAS |
827-15-6 |
EINECS |
212-565-2 |
מבנה מולקולרי |
|
צפיפות |
2.217g/cm3 |
נקודת רתיחה |
166.7°C at 760 mmHg |
משקל סגולי |
1.502 |
נקודת הבזק |
61.3°C |
לחץ אדים |
2.33mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|