ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
שם המוצר |
3-chloro-4-fluorophenylhydrazine |
שם אנגלי |
3-chloro-4-fluorophenylhydrazine; |
מולקולרית פורמולה |
C6H6ClFN2 |
משקל מולקולרי |
160.5766 |
InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
מספר CAS |
84282-78-0 |
מבנה מולקולרי |
|
צפיפות |
1.43g/cm3 |
נקודת ההתוך |
62-63℃ |
נקודת רתיחה |
253.1°C at 760 mmHg |
משקל סגולי |
1.624 |
נקודת הבזק |
106.9°C |
לחץ אדים |
0.0187mmHg at 25°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|