ChemNet > CAS > 85408-26-0 1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2)
85408-26-0 1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2)
שם המוצר |
1-Propene, 2-methyl-, reaction products with sulfur chloride (S2Cl2) |
נרדפות |
Reaction product of sulfur monochloride with isobutylene; chlorosulfanyl thiohypochlorite; 2-methylprop-1-ene |
מולקולרית פורמולה |
C4H8Cl2S2 |
משקל מולקולרי |
191.1423 |
InChI |
InChI=1/C4H8.Cl2S2/c1-4(2)3;1-3-4-2/h1H2,2-3H3; |
מספר CAS |
85408-26-0 |
EINECS |
286-986-5 |
מבנה מולקולרי |
|
Hazard סימנים |
|
סיכונים קודי |
|
בטיחות תיאור |
|
|