ChemNet > CAS > 85510-82-3 4-Bromo-2-fluorobenzyl chloride
85510-82-3 4-Bromo-2-fluorobenzyl chloride
שם המוצר |
4-Bromo-2-fluorobenzyl chloride |
שם אנגלי |
4-Bromo-2-fluorobenzyl chloride;4-bromo-1-(chloromethyl)-2-fluorobenzene |
מולקולרית פורמולה |
C7H5BrClF |
משקל מולקולרי |
223.47 |
InChI |
InChI=1/C7H5BrClF/c8-6-2-1-5(4-9)7(10)3-6/h1-3H,4H2 |
מספר CAS |
85510-82-3 |
מבנה מולקולרי |
|
צפיפות |
1.624g/cm3 |
נקודת רתיחה |
241.3°C at 760 mmHg |
משקל סגולי |
1.548 |
נקודת הבזק |
99.8°C |
לחץ אדים |
0.056mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
R36:Irritating to eyes.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|