ChemNet > CAS > 86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
86010-32-4 5-nitro-1-benzothiophene-2-carbonyl chloride
| שם המוצר |
5-nitro-1-benzothiophene-2-carbonyl chloride |
| שם אנגלי |
5-nitro-1-benzothiophene-2-carbonyl chloride; |
| מולקולרית פורמולה |
C9H4ClNO3S |
| משקל מולקולרי |
241.651 |
| InChI |
InChI=1/C9H4ClNO3S/c10-9(12)8-4-5-3-6(11(13)14)1-2-7(5)15-8/h1-4H |
| מספר CAS |
86010-32-4 |
| מבנה מולקולרי |
|
| צפיפות |
1.597g/cm3 |
| נקודת ההתוך |
158℃ |
| נקודת רתיחה |
401.7°C at 760 mmHg |
| משקל סגולי |
1.712 |
| נקודת הבזק |
196.7°C |
| לחץ אדים |
1.16E-06mmHg at 25°C |
| Hazard סימנים |
 C:Corrosive;
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
