ChemNet > CAS > 871-78-3 N,N'-Diacetylethylenediamine
871-78-3 N,N'-Diacetylethylenediamine
שם המוצר |
N,N'-Diacetylethylenediamine |
שם אנגלי |
N,N'-Diacetylethylenediamine; N,N-Diacetylethylenediamine; N,N'-ethane-1,2-diyldiacetamide |
מולקולרית פורמולה |
C6H12N2O2 |
משקל מולקולרי |
144.1717 |
InChI |
InChI=1/C6H12N2O2/c1-5(9)7-3-4-8-6(2)10/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
מספר CAS |
871-78-3 |
EINECS |
212-811-9 |
מבנה מולקולרי |
|
צפיפות |
1.033g/cm3 |
נקודת רתיחה |
438.7°C at 760 mmHg |
משקל סגולי |
1.444 |
נקודת הבזק |
214.8°C |
לחץ אדים |
6.74E-08mmHg at 25°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|